Catalog No. | Product Name | Summary | Targets | CAS Number | Smiles |
A2431 | Acarbose | Alpha-glucosidase inhibitor | Others | 56180-94-0 | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)NC4C=C(C(C(C4O)O)O)CO |
A4036 | Sitagliptin phosphate monohydrate | Potent DPP-4 inhibitor | DPP-4 | 654671-77-9 | [HH].C1CN2C(=NN=C2C(F)(F)F)CN1C(=O)CC(CC3=CC(=C(C=C3F)F)F)N.O.OOP(=O)=O |
A4156 | Rucaparib (AG-014699,PF-01367338) | Potent PARP inhibitor | PARP | 459868-92-9 | OP(O)(O)=O.FC1=CC2=C3C(CCNC2=O)=C(C4=CC=C(CNC)C=C4)NC3=C1 |
A5854 | Dapagliflozin | SGLT2 inhibitor,potent and selective | SGLT | 461432-26-8 | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)C3C(C(C(C(O3)CO)O)O)O)Cl |
A8333 | Canagliflozin | SGLT2 inhibitor,potent and selective | SGLT | 842133-18-0 | CC1=C(C=C(C=C1)C2C(C(C(C(O2)CO)O)O)O)CC3=CC=C(S3)C4=CC=C(C=C4)F |
A8339 | TAK-875 | GPR40 agonist | FFAR1 (GPR40) | 1000413-72-8 | CC1=CC(=CC(=C1C2=CC(=CC=C2)COC3=CC4=C(C=C3)C(CO4)CC(=O)O)C)OCCCS(=O)(=O)C |
B1373 | Phenformin HCl | biguanidine drug with anti-diabetic activity | Others | 834-28-6 | C1=CC=C(C=C1)CCN=C(N)N=C(N)N.Cl |
B2196 | Gliquidone | ATP-sensitive K+ channel antagonist | Potassium Channel | 33342-05-1 | CC1(C2=C(C=C(C=C2)OC)C(=O)N(C1=O)CCC3=CC=C(C=C3)S(=O)(=O)NC(=O)NC4CCCCC4)C |